C14H11NO4 — CID 155595313
3-hydroxy-4-(2-methoxyphenyl)-3H-furo[3,4-c]pyridin-1-one (PubChem CID 155595313) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-hydroxy-4-(2-methoxyphenyl)-3H-furo[3,4-c]pyridin-1-one.
| Compound Name | 3-hydroxy-4-(2-methoxyphenyl)-3H-furo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 155595313 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-hydroxy-4-(2-methoxyphenyl)-3H-furo[3,4-c]pyridin-1-one |
| SMILES | COc1ccccc1-c1nccc2c1C(O)OC2=O |
| InChI | InChI=1S/C14H11NO4/c1-18-10-5-3-2-4-8(10)12-11-9(6-7-15-12)13(16)19-14(11)17/h2-7,14,17H,1H3 |
| InChIKey | MTKSUACTMTXDQR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |