C26H32F2N2O5 — CID 155595731
1-[[(3,5-dimethoxy-4-methylphenyl)methyl-(4-phenylbutyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid (PubChem CID 155595731) has the molecular formula C26H32F2N2O5 and a molecular weight of 490.55 g/mol. Its IUPAC name is 1-[[(3,5-dimethoxy-4-methylphenyl)methyl-(4-phenylbutyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid.
| Compound Name | 1-[[(3,5-dimethoxy-4-methylphenyl)methyl-(4-phenylbutyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 155595731 |
| Molecular Formula | C26H32F2N2O5 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1-[[(3,5-dimethoxy-4-methylphenyl)methyl-(4-phenylbutyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid |
| SMILES | COc1cc(CN(CCCCc2ccccc2)C(=O)NC2(C(=O)O)CC(F)(F)C2)cc(OC)c1C |
| InChI | InChI=1S/C26H32F2N2O5/c1-18-21(34-2)13-20(14-22(18)35-3)15-30(12-8-7-11-19-9-5-4-6-10-19)24(33)29-25(23(31)32)16-26(27,28)17-25/h4-6,9-10,13-14H,7-8,11-12,15-17H2,1-3H3,(H,29,33)(H,31,32) |
| InChIKey | AOMYCYUNRGAILP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|