C46H54Si — CID 155595892
2-[[1-[(3,6-ditert-butyl-9H-fluoren-1-yl)-diphenylmethyl]cyclopenta-2,4-dien-1-yl]methyl]prop-2-enyl-trimethylsilane (PubChem CID 155595892) has the molecular formula C46H54Si and a molecular weight of 635.02 g/mol. Its IUPAC name is 2-[[1-[(3,6-ditert-butyl-9H-fluoren-1-yl)-diphenylmethyl]cyclopenta-2,4-dien-1-yl]methyl]prop-2-enyl-trimethylsilane.
| Compound Name | 2-[[1-[(3,6-ditert-butyl-9H-fluoren-1-yl)-diphenylmethyl]cyclopenta-2,4-dien-1-yl]methyl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 155595892 |
| Molecular Formula | C46H54Si |
| Molecular Weight | 635.02 g/mol |
| Exact Mass | 634.40 |
| IUPAC Name | 2-[[1-[(3,6-ditert-butyl-9H-fluoren-1-yl)-diphenylmethyl]cyclopenta-2,4-dien-1-yl]methyl]prop-2-enyl-trimethylsilane |
| SMILES | C=C(CC1(C(c2ccccc2)(c2ccccc2)c2cc(C(C)(C)C)cc3c2Cc2ccc(C(C)(C)C)cc2-3)C=CC=C1)C[Si](C)(C)C |
| InChI | InChI=1S/C46H54Si/c1-33(32-47(8,9)10)31-45(25-17-18-26-45)46(35-19-13-11-14-20-35,36-21-15-12-16-22-36)42-30-38(44(5,6)7)29-40-39-28-37(43(2,3)4)24-23-34(39)27-41(40)42/h11-26,28-30H,1,27,31-32H2,2-10H3 |
| InChIKey | VSQHZGSWZSJICT-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.02 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|