C29H41N — CID 155595920
3,5,5,8,8-pentamethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydronaphthalen-2-amine (PubChem CID 155595920) has the molecular formula C29H41N and a molecular weight of 403.65 g/mol. Its IUPAC name is 3,5,5,8,8-pentamethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydronaphthalen-2-amine.
| Compound Name | 3,5,5,8,8-pentamethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 155595920 |
| Molecular Formula | C29H41N |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | 3,5,5,8,8-pentamethyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydronaphthalen-2-amine |
| SMILES | Cc1cc2c(cc1Nc1ccc3c(c1)C(C)(C)CCC3(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H41N/c1-19-16-22-24(29(8,9)15-14-27(22,4)5)18-25(19)30-20-10-11-21-23(17-20)28(6,7)13-12-26(21,2)3/h10-11,16-18,30H,12-15H2,1-9H3 |
| InChIKey | BUQJKNMFSCQMAV-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |