C6H12O6 — CID 15559618
(3R,4R,5R)-3,5-bis(hydroxymethyl)oxolane-2,3,4-triol (PubChem CID 15559618) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is (3R,4R,5R)-3,5-bis(hydroxymethyl)oxolane-2,3,4-triol.
| Compound Name | (3R,4R,5R)-3,5-bis(hydroxymethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 15559618 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (3R,4R,5R)-3,5-bis(hydroxymethyl)oxolane-2,3,4-triol |
| SMILES | OC[C@H]1OC(O)[C@@](O)(CO)[C@@H]1O |
| InChI | InChI=1S/C6H12O6/c7-1-3-4(9)6(11,2-8)5(10)12-3/h3-5,7-11H,1-2H2/t3-,4-,5?,6-/m1/s1 |
| InChIKey | QQWKIYSNDOXBOU-DUVQVXGLSA-N |
| XLogP | -3.22 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |