C21H26N2O3 — CID 15559624
1-[(1R,4R,12R,16S)-7-hydroxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6(11),7,9-trien-5-yl]ethanone (PubChem CID 15559624) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(1R,4R,12R,16S)-7-hydroxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6(11),7,9-trien-5-yl]ethanone.
| Compound Name | 1-[(1R,4R,12R,16S)-7-hydroxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6(11),7,9-trien-5-yl]ethanone |
|---|---|
| PubChem CID | 15559624 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[(1R,4R,12R,16S)-7-hydroxy-17-oxa-5,15-diazahexacyclo[13.4.3.01,16.04,12.06,11.012,16]docosa-6(11),7,9-trien-5-yl]ethanone |
| SMILES | CC(=O)N1c2c(O)cccc2[C@@]23CCN4CCC[C@]5(CCO[C@@]452)CC[C@@H]13 |
| InChI | InChI=1S/C21H26N2O3/c1-14(24)23-17-6-8-19-7-3-11-22-12-9-20(17,21(19,22)26-13-10-19)15-4-2-5-16(25)18(15)23/h2,4-5,17,25H,3,6-13H2,1H3/t17-,19-,20-,21+/m1/s1 |
| InChIKey | OZHFIQIIDYNXAD-WLRLJWMZSA-N |
| XLogP | 2.76 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |