C7H7NS4 — CID 155596285
5-sulfanyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 155596285) has the molecular formula C7H7NS4 and a molecular weight of 233.41 g/mol. Its IUPAC name is 5-sulfanyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-sulfanyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 155596285 |
| Molecular Formula | C7H7NS4 |
| Molecular Weight | 233.41 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | 5-sulfanyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | S=C1C=C2SCCC2C(=S)N1S |
| InChI | InChI=1S/C7H7NS4/c9-6-3-5-4(1-2-12-5)7(10)8(6)11/h3-4,11H,1-2H2 |
| InChIKey | UJOKCLGEFCEPOG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|