C19H38N2 — CID 155596762
2,2,6,6-tetramethyl-N-(8-methylnon-1-en-2-yl)piperidin-4-amine (PubChem CID 155596762) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-(8-methylnon-1-en-2-yl)piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-(8-methylnon-1-en-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 155596762 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-(8-methylnon-1-en-2-yl)piperidin-4-amine |
| SMILES | C=C(CCCCCC(C)C)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C19H38N2/c1-15(2)11-9-8-10-12-16(3)20-17-13-18(4,5)21-19(6,7)14-17/h15,17,20-21H,3,8-14H2,1-2,4-7H3 |
| InChIKey | SRIULKIXLPKDNE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|