About 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole
4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole (PubChem CID 15559838) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole |
| PubChem CID | 15559838 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole |
| SMILES | C/C=C/c1cc(OC)c2c(c1OC)OCO2 |
| InChI | InChI=1S/C12H14O4/c1-4-5-8-6-9(13-2)11-12(10(8)14-3)16-7-15-11/h4-6H,7H2,1-3H3/b5-4+ |
| InChIKey | XKCIPTFOQRVXGG-SNAWJCMRSA-N |
| XLogP | 2.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole?
The IUPAC name of 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole (CID 15559838) is 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole.
What is the SMILES notation for 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole?
The canonical SMILES for 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole is C/C=C/c1cc(OC)c2c(c1OC)OCO2.
What is the InChIKey of 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole?
The InChIKey is XKCIPTFOQRVXGG-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H14O4/c1-4-5-8-6-9(13-2)11-12(10(8)14-3)16-7-15-11/h4-6H,7H2,1-3H3/b5-4+.
What are the key properties of 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole?
4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole has a molecular weight of 222.24 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole is sourced from PubChem (CID 15559838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).