C15H17FN2O3 — CID 155598519
(1S,12S)-5-fluoro-N-hydroxy-13-oxa-2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7-triene-7-carboxamide (PubChem CID 155598519) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is (1S,12S)-5-fluoro-N-hydroxy-13-oxa-2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7-triene-7-carboxamide.
| Compound Name | (1S,12S)-5-fluoro-N-hydroxy-13-oxa-2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7-triene-7-carboxamide |
|---|---|
| PubChem CID | 155598519 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (1S,12S)-5-fluoro-N-hydroxy-13-oxa-2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-4(9),5,7-triene-7-carboxamide |
| SMILES | O=C(NO)c1cc(F)c2c(c1)CC1[C@@H]3CC[C@@H](CO3)N1C2 |
| InChI | InChI=1S/C15H17FN2O3/c16-12-4-9(15(19)17-20)3-8-5-13-14-2-1-10(7-21-14)18(13)6-11(8)12/h3-4,10,13-14,20H,1-2,5-7H2,(H,17,19)/t10-,13?,14-/m0/s1 |
| InChIKey | WMLVAVDOBROZQI-LZRTYROISA-N |
| XLogP | 1.23 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|