About 2H-cyclopenta[c]pyridine
2H-cyclopenta[c]pyridine (PubChem CID 15559852) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2H-cyclopenta[c]pyridine.
Molecular Properties
| Compound Name | 2H-cyclopenta[c]pyridine |
| PubChem CID | 15559852 |
| Molecular Formula | C8H7N |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 2H-cyclopenta[c]pyridine |
| SMILES | c1cc2cc[nH]cc-2c1 |
| InChI | InChI=1S/C8H7N/c1-2-7-4-5-9-6-8(7)3-1/h1-6,9H |
| InChIKey | IVAATAQAFOAALG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-cyclopenta[c]pyridine?
The IUPAC name of 2H-cyclopenta[c]pyridine (CID 15559852) is 2H-cyclopenta[c]pyridine.
What is the SMILES notation for 2H-cyclopenta[c]pyridine?
The canonical SMILES for 2H-cyclopenta[c]pyridine is c1cc2cc[nH]cc-2c1.
What is the InChIKey of 2H-cyclopenta[c]pyridine?
The InChIKey is IVAATAQAFOAALG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N/c1-2-7-4-5-9-6-8(7)3-1/h1-6,9H.
What are the key properties of 2H-cyclopenta[c]pyridine?
2H-cyclopenta[c]pyridine has a molecular weight of 117.15 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-cyclopenta[c]pyridine is sourced from PubChem (CID 15559852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).