About N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide
N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide (PubChem CID 155598750) has the molecular formula C12H24N2O3S
and a molecular weight of 276.40 g/mol. Its IUPAC name is N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide.
Molecular Properties
| Compound Name | N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide |
| PubChem CID | 155598750 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide |
| SMILES | CC1(CNC=O)CCC(O)CC1.NC(=O)CCS |
| InChI | InChI=1S/C9H17NO2.C3H7NOS/c1-9(6-10-7-11)4-2-8(12)3-5-9;4-3(5)1-2-6/h7-8,12H,2-6H2,1H3,(H,10,11);6H,1-2H2,(H2,4,5) |
| InChIKey | XQLYFEYRNAFGAI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide?
The IUPAC name of N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide (CID 155598750) is N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide.
What is the SMILES notation for N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide?
The canonical SMILES for N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide is CC1(CNC=O)CCC(O)CC1.NC(=O)CCS.
What is the InChIKey of N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide?
The InChIKey is XQLYFEYRNAFGAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C3H7NOS/c1-9(6-10-7-11)4-2-8(12)3-5-9;4-3(5)1-2-6/h7-8,12H,2-6H2,1H3,(H,10,11);6H,1-2H2,(H2,4,5).
What are the key properties of N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide?
N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide has a molecular weight of 276.40 g/mol, XLogP of 0.47, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-hydroxy-1-methylcyclohexyl)methyl]formamide;3-sulfanylpropanamide is sourced from PubChem (CID 155598750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).