C27H44O5 — CID 15559887
5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-14,16-diol (PubChem CID 15559887) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is 5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-14,16-diol.
| Compound Name | 5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-14,16-diol |
|---|---|
| PubChem CID | 15559887 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-14,16-diol |
| SMILES | CC1C2C(CC3C4CCC5CC(O)CC(O)C5(C)C4CCC32C)OC12CCC(CO)CO2 |
| InChI | InChI=1S/C27H44O5/c1-15-24-22(32-27(15)9-6-16(13-28)14-31-27)12-21-19-5-4-17-10-18(29)11-23(30)26(17,3)20(19)7-8-25(21,24)2/h15-24,28-30H,4-14H2,1-3H3 |
| InChIKey | SMWGITAKOUTXKQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |