C19H13N2O4S- — CID 155598940
6-methoxycarbonyl-2-naphthalen-1-ylbenzimidazole-1-sulfinate (PubChem CID 155598940) has the molecular formula C19H13N2O4S- and a molecular weight of 365.39 g/mol. Its IUPAC name is 6-methoxycarbonyl-2-naphthalen-1-ylbenzimidazole-1-sulfinate.
| Compound Name | 6-methoxycarbonyl-2-naphthalen-1-ylbenzimidazole-1-sulfinate |
|---|---|
| PubChem CID | 155598940 |
| Molecular Formula | C19H13N2O4S- |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 6-methoxycarbonyl-2-naphthalen-1-ylbenzimidazole-1-sulfinate |
| SMILES | COC(=O)c1ccc2nc(-c3cccc4ccccc34)n(S(=O)[O-])c2c1 |
| InChI | InChI=1S/C19H14N2O4S/c1-25-19(22)13-9-10-16-17(11-13)21(26(23)24)18(20-16)15-8-4-6-12-5-2-3-7-14(12)15/h2-11H,1H3,(H,23,24)/p-1 |
| InChIKey | ZADVHFPCHFCGKR-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 84.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|