C37H38N10O5 — CID 155599189
N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide (PubChem CID 155599189) has the molecular formula C37H38N10O5 and a molecular weight of 702.78 g/mol. Its IUPAC name is N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 155599189 |
| Molecular Formula | C37H38N10O5 |
| Molecular Weight | 702.78 g/mol |
| Exact Mass | 702.30 |
| IUPAC Name | N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide |
| SMILES | CCCn1cc(-c2nc(Nc3ccc(C(=O)NCCCCCNc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)nc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C37H38N10O5/c1-2-19-46-21-23(20-41-46)31-26-15-18-39-32(26)45-37(44-31)42-24-11-9-22(10-12-24)33(49)40-17-5-3-4-16-38-27-8-6-7-25-30(27)36(52)47(35(25)51)28-13-14-29(48)43-34(28)50/h6-12,15,18,20-21,28,38H,2-5,13-14,16-17,19H2,1H3,(H,40,49)(H,43,48,50)(H2,39,42,44,45) |
| InChIKey | IIQDLBHJZXCCRN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 196.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|