C36H36N10O6 — CID 155599212
N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide (PubChem CID 155599212) has the molecular formula C36H36N10O6 and a molecular weight of 704.75 g/mol. Its IUPAC name is N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 155599212 |
| Molecular Formula | C36H36N10O6 |
| Molecular Weight | 704.75 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]-4-[[4-(1-propylpyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide |
| SMILES | CCCn1cc(-c2nc(Nc3ccc(C(=O)NCCOCCNc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)nc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C36H36N10O6/c1-2-16-45-20-22(19-40-45)30-25-12-13-38-31(25)44-36(43-30)41-23-8-6-21(7-9-23)32(48)39-15-18-52-17-14-37-26-5-3-4-24-29(26)35(51)46(34(24)50)27-10-11-28(47)42-33(27)49/h3-9,12-13,19-20,27,37H,2,10-11,14-18H2,1H3,(H,39,48)(H,42,47,49)(H2,38,41,43,44) |
| InChIKey | JRAOUSBLDNFFPC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 205.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|