C10H16N2OS2 — CID 155599564
3-[2-[2-(dimethylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione (PubChem CID 155599564) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-[2-[2-(dimethylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione.
| Compound Name | 3-[2-[2-(dimethylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 155599564 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[2-[2-(dimethylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione |
| SMILES | CN(C)CCOCCNc1cc(=S)c1=S |
| InChI | InChI=1S/C10H16N2OS2/c1-12(2)4-6-13-5-3-11-8-7-9(14)10(8)15/h7,11H,3-6H2,1-2H3 |
| InChIKey | YXVFVSHGVIPKQZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|