C23H41O2Si+ — CID 155599602
[(1R)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-dimethylsilanylium (PubChem CID 155599602) has the molecular formula C23H41O2Si+ and a molecular weight of 377.67 g/mol. Its IUPAC name is [(1R)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-dimethylsilanylium.
| Compound Name | [(1R)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-dimethylsilanylium |
|---|---|
| PubChem CID | 155599602 |
| Molecular Formula | C23H41O2Si+ |
| Molecular Weight | 377.67 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | [(1R)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]-dimethylsilanylium |
| SMILES | C[C@@H](O[SiH2+](C)C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H41O2Si/c1-15(25-26(4)5)19-8-9-20-18-7-6-16-14-17(24)10-12-22(16,2)21(18)11-13-23(19,20)3/h6,15,17-21,24H,7-14,26H2,1-5H3/q+1/t15-,17+,18+,19-,20+,21+,22+,23-/m1/s1 |
| InChIKey | IPPMTDXEQXLSSQ-YDDBCJSBSA-N |
| XLogP | 5.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|