C19H24N6O2S — CID 155599666
N-methyl-2-[4-[[3-(propylsulfanylamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole-4-carboxamide (PubChem CID 155599666) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is N-methyl-2-[4-[[3-(propylsulfanylamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-methyl-2-[4-[[3-(propylsulfanylamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 155599666 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-methyl-2-[4-[[3-(propylsulfanylamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCSNC1CC(Nc2c(-c3nc(C(=O)NC)co3)cnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C19H24N6O2S/c1-3-6-28-25-12-7-11(8-12)23-16-13-4-5-21-17(13)22-9-14(16)19-24-15(10-27-19)18(26)20-2/h4-5,9-12,25H,3,6-8H2,1-2H3,(H,20,26)(H2,21,22,23) |
| InChIKey | HGMGJAVYVCLLJU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|