C16H19N5O3S — CID 155599668
tert-butyl N-[[5-(4-methyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]oxycarbamate (PubChem CID 155599668) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is tert-butyl N-[[5-(4-methyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]oxycarbamate.
| Compound Name | tert-butyl N-[[5-(4-methyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]oxycarbamate |
|---|---|
| PubChem CID | 155599668 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | tert-butyl N-[[5-(4-methyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]oxycarbamate |
| SMILES | Cc1csc(-c2cnc3[nH]ccc3c2NONC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C16H19N5O3S/c1-9-8-25-14(19-9)11-7-18-13-10(5-6-17-13)12(11)20-24-21-15(22)23-16(2,3)4/h5-8H,1-4H3,(H,21,22)(H2,17,18,20) |
| InChIKey | JUGUIWOIQQHDOM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|