C22H20N6O3S2 — CID 155599694
3-[[3-[[5-(4-methylsulfonyl-1,3-oxazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]amino]sulfanylbenzonitrile (PubChem CID 155599694) has the molecular formula C22H20N6O3S2 and a molecular weight of 480.58 g/mol. Its IUPAC name is 3-[[3-[[5-(4-methylsulfonyl-1,3-oxazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]amino]sulfanylbenzonitrile.
| Compound Name | 3-[[3-[[5-(4-methylsulfonyl-1,3-oxazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]amino]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 155599694 |
| Molecular Formula | C22H20N6O3S2 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-[[3-[[5-(4-methylsulfonyl-1,3-oxazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]amino]sulfanylbenzonitrile |
| SMILES | CS(=O)(=O)c1coc(-c2cnc3[nH]ccc3c2NC2CC(NSc3cccc(C#N)c3)C2)n1 |
| InChI | InChI=1S/C22H20N6O3S2/c1-33(29,30)19-12-31-22(27-19)18-11-25-21-17(5-6-24-21)20(18)26-14-8-15(9-14)28-32-16-4-2-3-13(7-16)10-23/h2-7,11-12,14-15,28H,8-9H2,1H3,(H2,24,25,26) |
| InChIKey | KOMVXMUOFMHCPX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|