C17H22N6OS — CID 155599699
3-N-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine (PubChem CID 155599699) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is 3-N-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine.
| Compound Name | 3-N-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 155599699 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-N-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine |
| SMILES | CCCSNC1CC(Nc2c(-c3nnc(C)o3)cnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C17H22N6OS/c1-3-6-25-23-12-7-11(8-12)20-15-13-4-5-18-16(13)19-9-14(15)17-22-21-10(2)24-17/h4-5,9,11-12,23H,3,6-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | JQMVJTBELPSDEV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|