C17H21N5S2 — CID 155599735
1-N-propylsulfanyl-3-N-[5-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclobutane-1,3-diamine (PubChem CID 155599735) has the molecular formula C17H21N5S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-N-propylsulfanyl-3-N-[5-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclobutane-1,3-diamine.
| Compound Name | 1-N-propylsulfanyl-3-N-[5-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 155599735 |
| Molecular Formula | C17H21N5S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-N-propylsulfanyl-3-N-[5-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclobutane-1,3-diamine |
| SMILES | CCCSNC1CC(Nc2c(-c3nccs3)cnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C17H21N5S2/c1-2-6-24-22-12-8-11(9-12)21-15-13-3-4-18-16(13)20-10-14(15)17-19-5-7-23-17/h3-5,7,10-12,22H,2,6,8-9H2,1H3,(H2,18,20,21) |
| InChIKey | PAVDETZVGIRMJB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|