C16H20N6OS — CID 155599785
3-N-[5-(1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine (PubChem CID 155599785) has the molecular formula C16H20N6OS and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-N-[5-(1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine.
| Compound Name | 3-N-[5-(1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 155599785 |
| Molecular Formula | C16H20N6OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-N-[5-(1,3,4-oxadiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-N-propylsulfanylcyclobutane-1,3-diamine |
| SMILES | CCCSNC1CC(Nc2c(-c3nnco3)cnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C16H20N6OS/c1-2-5-24-22-11-6-10(7-11)20-14-12-3-4-17-15(12)18-8-13(14)16-21-19-9-23-16/h3-4,8-11,22H,2,5-7H2,1H3,(H2,17,18,20) |
| InChIKey | ZGAURFRABXLVAC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|