C23H23N7OS2 — CID 155599797
2-(4-amino-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-1,3-thiazole-4-carboxamide;3-(cyclobutylamino)sulfanylbenzonitrile (PubChem CID 155599797) has the molecular formula C23H23N7OS2 and a molecular weight of 477.62 g/mol. Its IUPAC name is 2-(4-amino-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-1,3-thiazole-4-carboxamide;3-(cyclobutylamino)sulfanylbenzonitrile.
| Compound Name | 2-(4-amino-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-1,3-thiazole-4-carboxamide;3-(cyclobutylamino)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 155599797 |
| Molecular Formula | C23H23N7OS2 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-(4-amino-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-1,3-thiazole-4-carboxamide;3-(cyclobutylamino)sulfanylbenzonitrile |
| SMILES | CNC(=O)c1csc(-c2cnc3[nH]ccc3c2N)n1.N#Cc1cccc(SNC2CCC2)c1 |
| InChI | InChI=1S/C12H11N5OS.C11H12N2S/c1-14-11(18)8-5-19-12(17-8)7-4-16-10-6(9(7)13)2-3-15-10;12-8-9-3-1-6-11(7-9)14-13-10-4-2-5-10/h2-5H,1H3,(H,14,18)(H3,13,15,16);1,3,6-7,10,13H,2,4-5H2 |
| InChIKey | RRVBSDBPLYUNNL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|