C19H15N7O4S2 — CID 155599814
2-[4-[[(3-cyanophenyl)sulfonylamino]oxyamino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 155599814) has the molecular formula C19H15N7O4S2 and a molecular weight of 469.51 g/mol. Its IUPAC name is 2-[4-[[(3-cyanophenyl)sulfonylamino]oxyamino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-[[(3-cyanophenyl)sulfonylamino]oxyamino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155599814 |
| Molecular Formula | C19H15N7O4S2 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 2-[4-[[(3-cyanophenyl)sulfonylamino]oxyamino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(-c2cnc3[nH]ccc3c2NONS(=O)(=O)c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C19H15N7O4S2/c1-21-18(27)15-10-31-19(24-15)14-9-23-17-13(5-6-22-17)16(14)25-30-26-32(28,29)12-4-2-3-11(7-12)8-20/h2-7,9-10,26H,1H3,(H,21,27)(H2,22,23,25) |
| InChIKey | BYWMIFRXDZUHOV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 161.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|