About 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline
1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline (PubChem CID 155600048) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline.
Molecular Properties
| Compound Name | 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline |
| PubChem CID | 155600048 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline |
| SMILES | Cn1ccc2c1Nc1ccccc1C2(C)C |
| InChI | InChI=1S/C14H16N2/c1-14(2)10-6-4-5-7-12(10)15-13-11(14)8-9-16(13)3/h4-9,15H,1-3H3 |
| InChIKey | UBWHVYPFUFCLQV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline?
The IUPAC name of 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline (CID 155600048) is 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline.
What is the SMILES notation for 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline?
The canonical SMILES for 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline is Cn1ccc2c1Nc1ccccc1C2(C)C.
What is the InChIKey of 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline?
The InChIKey is UBWHVYPFUFCLQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-14(2)10-6-4-5-7-12(10)15-13-11(14)8-9-16(13)3/h4-9,15H,1-3H3.
What are the key properties of 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline?
1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline has a molecular weight of 212.30 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,4-trimethyl-9H-pyrrolo[2,3-b]quinoline is sourced from PubChem (CID 155600048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).