C36H34FN5O6 — CID 155600124
2-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-3-fluorophenyl]-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetamide (PubChem CID 155600124) has the molecular formula C36H34FN5O6 and a molecular weight of 651.69 g/mol. Its IUPAC name is 2-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-3-fluorophenyl]-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetamide.
| Compound Name | 2-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-3-fluorophenyl]-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 155600124 |
| Molecular Formula | C36H34FN5O6 |
| Molecular Weight | 651.69 g/mol |
| Exact Mass | 651.25 |
| IUPAC Name | 2-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-3-fluorophenyl]-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetamide |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(C(C(N)=O)(c4ccccc4)N4Cc5ccccc5C4=O)cc3F)c2cc1OCCOC |
| InChI | InChI=1S/C36H34FN5O6/c1-45-14-16-47-31-19-27-30(20-32(31)48-17-15-46-2)39-22-40-33(27)41-29-13-12-25(18-28(29)37)36(35(38)44,24-9-4-3-5-10-24)42-21-23-8-6-7-11-26(23)34(42)43/h3-13,18-20,22H,14-17,21H2,1-2H3,(H2,38,44)(H,39,40,41) |
| InChIKey | TUVJXZHCFOSDTK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|