C23H37NO6 — CID 15560081
11-ethyl-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13-triol (PubChem CID 15560081) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is 11-ethyl-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13-triol.
| Compound Name | 11-ethyl-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13-triol |
|---|---|
| PubChem CID | 15560081 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 11-ethyl-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13-triol |
| SMILES | CCN1CC2(O)CCC(OC)C34C1C(CC23)C1(O)CC(OC)C2CC4C1(O)C2OC |
| InChI | InChI=1S/C23H37NO6/c1-5-24-11-20(25)7-6-17(29-3)22-15(20)9-13(18(22)24)21(26)10-14(28-2)12-8-16(22)23(21,27)19(12)30-4/h12-19,25-27H,5-11H2,1-4H3 |
| InChIKey | ZBSZKFYYJKXUHF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |