About 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine
1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine (PubChem CID 155600929) has the molecular formula C17H23F2NO2S
and a molecular weight of 343.44 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine |
| PubChem CID | 155600929 |
| Molecular Formula | C17H23F2NO2S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine |
| SMILES | CC(C)(C)S(=O)(=O)N1CC(F)(F)CC1c1ccccc1C1CC1 |
| InChI | InChI=1S/C17H23F2NO2S/c1-16(2,3)23(21,22)20-11-17(18,19)10-15(20)14-7-5-4-6-13(14)12-8-9-12/h4-7,12,15H,8-11H2,1-3H3 |
| InChIKey | OCDYXUWMOASTAO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
The IUPAC name of 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine (CID 155600929) is 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine.
What is the SMILES notation for 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
The canonical SMILES for 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine is CC(C)(C)S(=O)(=O)N1CC(F)(F)CC1c1ccccc1C1CC1.
What is the InChIKey of 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
The InChIKey is OCDYXUWMOASTAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F2NO2S/c1-16(2,3)23(21,22)20-11-17(18,19)10-15(20)14-7-5-4-6-13(14)12-8-9-12/h4-7,12,15H,8-11H2,1-3H3.
What are the key properties of 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine has a molecular weight of 343.44 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfonyl-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine is sourced from PubChem (CID 155600929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).