C21H15F2O3S+ — CID 155601812
2-(2,8-difluorodibenzothiophen-5-ium-5-yl)-5-methoxy-4-methylbenzoic acid (PubChem CID 155601812) has the molecular formula C21H15F2O3S+ and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-(2,8-difluorodibenzothiophen-5-ium-5-yl)-5-methoxy-4-methylbenzoic acid.
| Compound Name | 2-(2,8-difluorodibenzothiophen-5-ium-5-yl)-5-methoxy-4-methylbenzoic acid |
|---|---|
| PubChem CID | 155601812 |
| Molecular Formula | C21H15F2O3S+ |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-(2,8-difluorodibenzothiophen-5-ium-5-yl)-5-methoxy-4-methylbenzoic acid |
| SMILES | COc1cc(C(=O)O)c(-[s+]2c3ccc(F)cc3c3cc(F)ccc32)cc1C |
| InChI | InChI=1S/C21H14F2O3S/c1-11-7-20(16(21(24)25)10-17(11)26-2)27-18-5-3-12(22)8-14(18)15-9-13(23)4-6-19(15)27/h3-10H,1-2H3/p+1 |
| InChIKey | SYDXJJDVJBJYLU-UHFFFAOYSA-O |
| XLogP | 6.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|