C17H23F3NO7S2- — CID 155602041
[4-[4-(2-methoxyethoxycarbonyl)hexan-2-yl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 155602041) has the molecular formula C17H23F3NO7S2- and a molecular weight of 474.50 g/mol. Its IUPAC name is [4-[4-(2-methoxyethoxycarbonyl)hexan-2-yl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-[4-(2-methoxyethoxycarbonyl)hexan-2-yl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 155602041 |
| Molecular Formula | C17H23F3NO7S2- |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [4-[4-(2-methoxyethoxycarbonyl)hexan-2-yl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCC(CC(C)c1ccc(S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1)C(=O)OCCOC |
| InChI | InChI=1S/C17H23F3NO7S2/c1-4-13(16(22)28-10-9-27-3)11-12(2)14-5-7-15(8-6-14)29(23,24)21-30(25,26)17(18,19)20/h5-8,12-13H,4,9-11H2,1-3H3/q-1 |
| InChIKey | XKFBBMAFPRPGCL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|