C28H41ClN2O3 — CID 155602306
4-chloro-2-[(2E,4E)-5-[(1R,2R,6R)-3-(cyclopropylamino)-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxymethyliminomethyl]-3-methoxy-5-methylphenol (PubChem CID 155602306) has the molecular formula C28H41ClN2O3 and a molecular weight of 489.10 g/mol. Its IUPAC name is 4-chloro-2-[(2E,4E)-5-[(1R,2R,6R)-3-(cyclopropylamino)-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxymethyliminomethyl]-3-methoxy-5-methylphenol.
| Compound Name | 4-chloro-2-[(2E,4E)-5-[(1R,2R,6R)-3-(cyclopropylamino)-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxymethyliminomethyl]-3-methoxy-5-methylphenol |
|---|---|
| PubChem CID | 155602306 |
| Molecular Formula | C28H41ClN2O3 |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 4-chloro-2-[(2E,4E)-5-[(1R,2R,6R)-3-(cyclopropylamino)-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxymethyliminomethyl]-3-methoxy-5-methylphenol |
| SMILES | COc1c(Cl)c(C)c(/C=N/CO)c(O)c1C/C=C(C)/C=C/[C@@]1(C)[C@H](C)CCC(NC2CC2)[C@@H]1C |
| InChI | InChI=1S/C28H41ClN2O3/c1-17(13-14-28(5)18(2)8-12-24(20(28)4)31-21-9-10-21)7-11-22-26(33)23(15-30-16-32)19(3)25(29)27(22)34-6/h7,13-15,18,20-21,24,31-33H,8-12,16H2,1-6H3/b14-13+,17-7+,30-15+/t18-,20+,24?,28+/m1/s1 |
| InChIKey | LOTPEBHYENWSRV-XAYHMOOUSA-N |
| XLogP | 5.97 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|