C36H34N4O — CID 155602852
(5S)-2-(3-cyclopropyl-1-tritylindazol-5-yl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 155602852) has the molecular formula C36H34N4O and a molecular weight of 538.70 g/mol. Its IUPAC name is (5S)-2-(3-cyclopropyl-1-tritylindazol-5-yl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5S)-2-(3-cyclopropyl-1-tritylindazol-5-yl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 155602852 |
| Molecular Formula | C36H34N4O |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (5S)-2-(3-cyclopropyl-1-tritylindazol-5-yl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | O=C1N(c2ccc3c(c2)c(C2CC2)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)CC[C@]12CCNC2 |
| InChI | InChI=1S/C36H34N4O/c41-34-35(20-22-37-25-35)21-23-39(34)30-18-19-32-31(24-30)33(26-16-17-26)38-40(32)36(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-15,18-19,24,26,37H,16-17,20-23,25H2/t35-/m0/s1 |
| InChIKey | GDPCSQPOASDNCL-DHUJRADRSA-N |
| XLogP | 6.47 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|