About 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide
1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide (PubChem CID 15560295) has the molecular formula C6H10BrNO2
and a molecular weight of 208.05 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide.
Analyze 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide?
The IUPAC name of 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide (CID 15560295) is 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide.
What is the SMILES notation for 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide?
The canonical SMILES for 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide is Br.O=C(O)C1=CCCNC1.
What is the InChIKey of 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide?
The InChIKey is CAQYXXITPFGYGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.BrH/c8-6(9)5-2-1-3-7-4-5;/h2,7H,1,3-4H2,(H,8,9);1H.
What are the key properties of 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide?
1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide has a molecular weight of 208.05 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,6-tetrahydropyridine-5-carboxylic acid;hydrobromide is sourced from PubChem (CID 15560295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).