C30H25BO3S — CID 155603355
2-(1-dibenzothiophen-3-yldibenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155603355) has the molecular formula C30H25BO3S and a molecular weight of 476.41 g/mol. Its IUPAC name is 2-(1-dibenzothiophen-3-yldibenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-dibenzothiophen-3-yldibenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155603355 |
| Molecular Formula | C30H25BO3S |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-(1-dibenzothiophen-3-yldibenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c(c3)sc3ccccc34)c3c2oc2ccccc23)OC1(C)C |
| InChI | InChI=1S/C30H25BO3S/c1-29(2)30(3,4)34-31(33-29)23-16-15-19(27-22-10-5-7-11-24(22)32-28(23)27)18-13-14-21-20-9-6-8-12-25(20)35-26(21)17-18/h5-17H,1-4H3 |
| InChIKey | HMGIJMMQAUKABY-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|