C45H25N5 — CID 155603824
9-[3-[3-(2-carbazol-9-yl-6-cyanophenyl)phenyl]phenyl]-8-isocyanocarbazole-3-carbonitrile (PubChem CID 155603824) has the molecular formula C45H25N5 and a molecular weight of 635.73 g/mol. Its IUPAC name is 9-[3-[3-(2-carbazol-9-yl-6-cyanophenyl)phenyl]phenyl]-8-isocyanocarbazole-3-carbonitrile.
| Compound Name | 9-[3-[3-(2-carbazol-9-yl-6-cyanophenyl)phenyl]phenyl]-8-isocyanocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 155603824 |
| Molecular Formula | C45H25N5 |
| Molecular Weight | 635.73 g/mol |
| Exact Mass | 635.21 |
| IUPAC Name | 9-[3-[3-(2-carbazol-9-yl-6-cyanophenyl)phenyl]phenyl]-8-isocyanocarbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1cccc2c3cc(C#N)ccc3n(-c3cccc(-c4cccc(-c5c(C#N)cccc5-n5c6ccccc6c6ccccc65)c4)c3)c12 |
| InChI | InChI=1S/C45H25N5/c1-48-39-18-9-17-37-38-24-29(27-46)22-23-42(38)49(45(37)39)34-14-7-11-31(26-34)30-10-6-12-32(25-30)44-33(28-47)13-8-21-43(44)50-40-19-4-2-15-35(40)36-16-3-5-20-41(36)50/h2-26H |
| InChIKey | VAELLAQIKYJQFW-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.73 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|