C44H26N4 — CID 155604698
3-carbazol-9-yl-5-[4-[2-(2-isocyanocarbazol-9-yl)phenyl]phenyl]benzonitrile (PubChem CID 155604698) has the molecular formula C44H26N4 and a molecular weight of 610.72 g/mol. Its IUPAC name is 3-carbazol-9-yl-5-[4-[2-(2-isocyanocarbazol-9-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 3-carbazol-9-yl-5-[4-[2-(2-isocyanocarbazol-9-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 155604698 |
| Molecular Formula | C44H26N4 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 3-carbazol-9-yl-5-[4-[2-(2-isocyanocarbazol-9-yl)phenyl]phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc2c3ccccc3n(-c3ccccc3-c3ccc(-c4cc(C#N)cc(-n5c6ccccc6c6ccccc65)c4)cc3)c2c1 |
| InChI | InChI=1S/C44H26N4/c1-46-33-22-23-39-38-13-5-9-17-43(38)48(44(39)27-33)40-14-6-2-10-35(40)31-20-18-30(19-21-31)32-24-29(28-45)25-34(26-32)47-41-15-7-3-11-36(41)37-12-4-8-16-42(37)47/h2-27H |
| InChIKey | QXAUPPJACVGGRY-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|