About 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate
2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate (PubChem CID 155605257) has the molecular formula C15H20Br2N2O2
and a molecular weight of 420.15 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate |
| PubChem CID | 155605257 |
| Molecular Formula | C15H20Br2N2O2 |
| Molecular Weight | 420.15 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate |
| SMILES | CC(C)(OC(=O)c1cc(Br)cc(Br)c1N)C1CCNCC1 |
| InChI | InChI=1S/C15H20Br2N2O2/c1-15(2,9-3-5-19-6-4-9)21-14(20)11-7-10(16)8-12(17)13(11)18/h7-9,19H,3-6,18H2,1-2H3 |
| InChIKey | AZZHUAHJKMBRPO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.15 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate (CID 155605257) is 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate is CC(C)(OC(=O)c1cc(Br)cc(Br)c1N)C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate?
The InChIKey is AZZHUAHJKMBRPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Br2N2O2/c1-15(2,9-3-5-19-6-4-9)21-14(20)11-7-10(16)8-12(17)13(11)18/h7-9,19H,3-6,18H2,1-2H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate?
2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate has a molecular weight of 420.15 g/mol, XLogP of 3.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl 2-amino-3,5-dibromobenzoate is sourced from PubChem (CID 155605257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).