C13H30N2O — CID 155605599
N,N'-di(propan-2-yl)-1-propan-2-yloxybutane-1,4-diamine (PubChem CID 155605599) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)-1-propan-2-yloxybutane-1,4-diamine.
| Compound Name | N,N'-di(propan-2-yl)-1-propan-2-yloxybutane-1,4-diamine |
|---|---|
| PubChem CID | 155605599 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | N,N'-di(propan-2-yl)-1-propan-2-yloxybutane-1,4-diamine |
| SMILES | CC(C)NCCCC(NC(C)C)OC(C)C |
| InChI | InChI=1S/C13H30N2O/c1-10(2)14-9-7-8-13(15-11(3)4)16-12(5)6/h10-15H,7-9H2,1-6H3 |
| InChIKey | OHKMKAOPNJRWNM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|