C23H30N4O8 — CID 155607021
tert-butyl 2-[[2,2-dimethylpropyl-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate (PubChem CID 155607021) has the molecular formula C23H30N4O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is tert-butyl 2-[[2,2-dimethylpropyl-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate.
| Compound Name | tert-butyl 2-[[2,2-dimethylpropyl-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 155607021 |
| Molecular Formula | C23H30N4O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | tert-butyl 2-[[2,2-dimethylpropyl-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate |
| SMILES | CC(C)(C)CN(C(=O)CN1C(=O)C=CC1=O)N(CC(=O)OC(C)(C)C)C(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H30N4O8/c1-22(2,3)14-27(20(33)12-25-17(30)9-10-18(25)31)26(13-21(34)35-23(4,5)6)19(32)11-24-15(28)7-8-16(24)29/h7-10H,11-14H2,1-6H3 |
| InChIKey | HVEIHXHIQYWJQC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 141.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|