About (6-ethyl-4,5-difluoropiperidin-2-yl)methanol
(6-ethyl-4,5-difluoropiperidin-2-yl)methanol (PubChem CID 155607395) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is (6-ethyl-4,5-difluoropiperidin-2-yl)methanol.
Molecular Properties
| Compound Name | (6-ethyl-4,5-difluoropiperidin-2-yl)methanol |
| PubChem CID | 155607395 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (6-ethyl-4,5-difluoropiperidin-2-yl)methanol |
| SMILES | CCC1NC(CO)CC(F)C1F |
| InChI | InChI=1S/C8H15F2NO/c1-2-7-8(10)6(9)3-5(4-12)11-7/h5-8,11-12H,2-4H2,1H3 |
| InChIKey | RDFOZCXDMAMRNG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-ethyl-4,5-difluoropiperidin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethyl-4,5-difluoropiperidin-2-yl)methanol?
The IUPAC name of (6-ethyl-4,5-difluoropiperidin-2-yl)methanol (CID 155607395) is (6-ethyl-4,5-difluoropiperidin-2-yl)methanol.
What is the SMILES notation for (6-ethyl-4,5-difluoropiperidin-2-yl)methanol?
The canonical SMILES for (6-ethyl-4,5-difluoropiperidin-2-yl)methanol is CCC1NC(CO)CC(F)C1F.
What is the InChIKey of (6-ethyl-4,5-difluoropiperidin-2-yl)methanol?
The InChIKey is RDFOZCXDMAMRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO/c1-2-7-8(10)6(9)3-5(4-12)11-7/h5-8,11-12H,2-4H2,1H3.
What are the key properties of (6-ethyl-4,5-difluoropiperidin-2-yl)methanol?
(6-ethyl-4,5-difluoropiperidin-2-yl)methanol has a molecular weight of 179.21 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethyl-4,5-difluoropiperidin-2-yl)methanol is sourced from PubChem (CID 155607395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).