C56H41IrN6O — CID 155607599
iridium(3+);9-phenyl-3-[6-(9-phenylpyrido[2,3-b]indol-3-yl)hexyl]pyrido[2,3-b]indole;6-pyridin-2-yl-7H-[1]benzofuro[3,2-b]pyridin-7-ide (PubChem CID 155607599) has the molecular formula C56H41IrN6O and a molecular weight of 1006.20 g/mol. Its IUPAC name is iridium(3+);9-phenyl-3-[6-(9-phenylpyrido[2,3-b]indol-3-yl)hexyl]pyrido[2,3-b]indole;6-pyridin-2-yl-7H-[1]benzofuro[3,2-b]pyridin-7-ide.
| Compound Name | iridium(3+);9-phenyl-3-[6-(9-phenylpyrido[2,3-b]indol-3-yl)hexyl]pyrido[2,3-b]indole;6-pyridin-2-yl-7H-[1]benzofuro[3,2-b]pyridin-7-ide |
|---|---|
| PubChem CID | 155607599 |
| Molecular Formula | C56H41IrN6O |
| Molecular Weight | 1006.20 g/mol |
| Exact Mass | 1006.30 |
| IUPAC Name | iridium(3+);9-phenyl-3-[6-(9-phenylpyrido[2,3-b]indol-3-yl)hexyl]pyrido[2,3-b]indole;6-pyridin-2-yl-7H-[1]benzofuro[3,2-b]pyridin-7-ide |
| SMILES | [Ir+3].[c-]1ccc2c(oc3cccnc32)c1-c1ccccn1.[c-]1ccccc1-n1c2ccccc2c2cc(CCCCCCc3cnc4c(c3)c3ccccc3n4-c3[c-]cccc3)cnc21 |
| InChI | InChI=1S/C40H32N4.C16H9N2O.Ir/c1(5-15-29-25-35-33-21-11-13-23-37(33)43(39(35)41-27-29)31-17-7-3-8-18-31)2-6-16-30-26-36-34-22-12-14-24-38(34)44(40(36)42-28-30)32-19-9-4-10-20-32;1-2-9-17-13(7-1)11-5-3-6-12-15-14(19-16(11)12)8-4-10-18-15;/h3-4,7-14,17,19,21-28H,1-2,5-6,15-16H2;1-4,6-10H;/q-2;-1;+3 |
| InChIKey | ZZWPKUQYFLDYNU-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.20 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|