C19H29NO3 — CID 155607913
1,1,2,3,6,6,7,7,11b-nonadeuterio-10-methoxy-3-(2-methylpropyl)-9-(trideuteriomethoxy)-4H-benzo[a]quinolizin-2-ol (PubChem CID 155607913) has the molecular formula C19H29NO3 and a molecular weight of 331.52 g/mol. Its IUPAC name is 1,1,2,3,6,6,7,7,11b-nonadeuterio-10-methoxy-3-(2-methylpropyl)-9-(trideuteriomethoxy)-4H-benzo[a]quinolizin-2-ol.
| Compound Name | 1,1,2,3,6,6,7,7,11b-nonadeuterio-10-methoxy-3-(2-methylpropyl)-9-(trideuteriomethoxy)-4H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 155607913 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 1,1,2,3,6,6,7,7,11b-nonadeuterio-10-methoxy-3-(2-methylpropyl)-9-(trideuteriomethoxy)-4H-benzo[a]quinolizin-2-ol |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC)C1([2H])N(CC([2H])(CC(C)C)C([2H])(O)C1([2H])[2H])C([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C19H29NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16-17,21H,5-7,10-11H2,1-4H3/i3D3,5D2,6D2,10D2,14D,16D,17D |
| InChIKey | WEQLWGNDNRARGE-QVEGZEJTSA-N |
| XLogP | 3.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |