C21H40N10 — CID 155608229
(Z)-3-[amino(2-methylpropyl)amino]-1-N,1-N-bis[[1-(2-methylpropyl)triazol-4-yl]methyl]prop-2-ene-1,2-diamine (PubChem CID 155608229) has the molecular formula C21H40N10 and a molecular weight of 432.62 g/mol. Its IUPAC name is (Z)-3-[amino(2-methylpropyl)amino]-1-N,1-N-bis[[1-(2-methylpropyl)triazol-4-yl]methyl]prop-2-ene-1,2-diamine.
| Compound Name | (Z)-3-[amino(2-methylpropyl)amino]-1-N,1-N-bis[[1-(2-methylpropyl)triazol-4-yl]methyl]prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 155608229 |
| Molecular Formula | C21H40N10 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (Z)-3-[amino(2-methylpropyl)amino]-1-N,1-N-bis[[1-(2-methylpropyl)triazol-4-yl]methyl]prop-2-ene-1,2-diamine |
| SMILES | CC(C)CN(N)/C=C(\N)CN(Cc1cn(CC(C)C)nn1)Cc1cn(CC(C)C)nn1 |
| InChI | InChI=1S/C21H40N10/c1-16(2)7-29(23)11-19(22)10-28(12-20-14-30(26-24-20)8-17(3)4)13-21-15-31(27-25-21)9-18(5)6/h11,14-18H,7-10,12-13,22-23H2,1-6H3/b19-11- |
| InChIKey | ABHIPKMBRXZTPN-ODLFYWEKSA-N |
| XLogP | 1.82 |
| TPSA | 119.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|