About [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate
[(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 155609314) has the molecular formula C14H22NO8P
and a molecular weight of 363.30 g/mol. Its IUPAC name is [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate.
Molecular Properties
| Compound Name | [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate |
| PubChem CID | 155609314 |
| Molecular Formula | C14H22NO8P |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | COC[C@]1(OC(C)n2ccccc2=O)COC[C@H]1OP(=O)(O)OC |
| InChI | InChI=1S/C14H22NO8P/c1-11(15-7-5-4-6-13(15)16)22-14(9-19-2)10-21-8-12(14)23-24(17,18)20-3/h4-7,11-12H,8-10H2,1-3H3,(H,17,18)/t11?,12-,14+/m1/s1 |
| InChIKey | LISDYESRADYFBJ-AOUZGSJDSA-N |
| XLogP | 0.93 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate?
The IUPAC name of [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate (CID 155609314) is [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate.
What is the SMILES notation for [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate?
The canonical SMILES for [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate is COC[C@]1(OC(C)n2ccccc2=O)COC[C@H]1OP(=O)(O)OC.
What is the InChIKey of [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate?
The InChIKey is LISDYESRADYFBJ-AOUZGSJDSA-N. The full InChI is InChI=1S/C14H22NO8P/c1-11(15-7-5-4-6-13(15)16)22-14(9-19-2)10-21-8-12(14)23-24(17,18)20-3/h4-7,11-12H,8-10H2,1-3H3,(H,17,18)/t11?,12-,14+/m1/s1.
What are the key properties of [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate?
[(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate has a molecular weight of 363.30 g/mol, XLogP of 0.93, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-(methoxymethyl)-4-[1-(2-oxo-1-pyridinyl)ethoxy]oxolan-3-yl] methyl hydrogen phosphate is sourced from PubChem (CID 155609314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).