C29H23N5 — CID 155609581
1-methyl-3-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-2H-imidazo[4,5-b]pyridine (PubChem CID 155609581) has the molecular formula C29H23N5 and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-methyl-3-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-2H-imidazo[4,5-b]pyridine.
| Compound Name | 1-methyl-3-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-2H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 155609581 |
| Molecular Formula | C29H23N5 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 1-methyl-3-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-2H-imidazo[4,5-b]pyridine |
| SMILES | CN1CN(c2cccc(C3(c4ccn[nH]4)c4ccccc4-c4ccccc43)c2)c2ncccc21 |
| InChI | InChI=1S/C29H23N5/c1-33-19-34(28-26(33)14-7-16-30-28)21-9-6-8-20(18-21)29(27-15-17-31-32-27)24-12-4-2-10-22(24)23-11-3-5-13-25(23)29/h2-18H,19H2,1H3,(H,31,32) |
| InChIKey | HWDPEURQJPVMDH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|