C59H58BN3 — CID 155609796
3-N,7-N-bis(4-methylphenyl)-3-N,7-N,5-triphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine-3,7-diamine (PubChem CID 155609796) has the molecular formula C59H58BN3 and a molecular weight of 819.95 g/mol. Its IUPAC name is 3-N,7-N-bis(4-methylphenyl)-3-N,7-N,5-triphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine-3,7-diamine.
| Compound Name | 3-N,7-N-bis(4-methylphenyl)-3-N,7-N,5-triphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine-3,7-diamine |
|---|---|
| PubChem CID | 155609796 |
| Molecular Formula | C59H58BN3 |
| Molecular Weight | 819.95 g/mol |
| Exact Mass | 819.47 |
| IUPAC Name | 3-N,7-N-bis(4-methylphenyl)-3-N,7-N,5-triphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzazaborinine-3,7-diamine |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc3c(c2)N(c2ccccc2)c2cc(N(c4ccccc4)c4ccc(C)cc4)ccc2B3c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc1 |
| InChI | InChI=1S/C59H58BN3/c1-40(2)45-36-53(41(3)4)59(54(37-45)42(5)6)60-55-34-32-51(61(46-18-12-9-13-19-46)49-28-24-43(7)25-29-49)38-57(55)63(48-22-16-11-17-23-48)58-39-52(33-35-56(58)60)62(47-20-14-10-15-21-47)50-30-26-44(8)27-31-50/h9-42H,1-8H3 |
| InChIKey | OIKOVQSIGKSTEF-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.95 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|