About 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum
4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum (PubChem CID 155610131) has the molecular formula C25H17N3O2Pt
and a molecular weight of 586.51 g/mol. Its IUPAC name is 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum.
Molecular Properties
| Compound Name | 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum |
| PubChem CID | 155610131 |
| Molecular Formula | C25H17N3O2Pt |
| Molecular Weight | 586.51 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum |
| SMILES | Oc1cnccc1-c1cc2ccccc2c(/C=N/c2cccc3cccc(O)c23)n1.[Pt] |
| InChI | InChI=1S/C25H17N3O2.Pt/c29-23-10-4-7-16-6-3-9-20(25(16)23)27-14-22-18-8-2-1-5-17(18)13-21(28-22)19-11-12-26-15-24(19)30;/h1-15,29-30H;/b27-14+; |
| InChIKey | YCCBESRCYVZDMV-RRIBZKRYSA-N |
| XLogP | 5.61 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum?
The IUPAC name of 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum (CID 155610131) is 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum.
What is the SMILES notation for 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum?
The canonical SMILES for 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum is Oc1cnccc1-c1cc2ccccc2c(/C=N/c2cccc3cccc(O)c23)n1.[Pt].
What is the InChIKey of 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum?
The InChIKey is YCCBESRCYVZDMV-RRIBZKRYSA-N. The full InChI is InChI=1S/C25H17N3O2.Pt/c29-23-10-4-7-16-6-3-9-20(25(16)23)27-14-22-18-8-2-1-5-17(18)13-21(28-22)19-11-12-26-15-24(19)30;/h1-15,29-30H;/b27-14+;.
What are the key properties of 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum?
4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum has a molecular weight of 586.51 g/mol, XLogP of 5.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]pyridin-3-ol;platinum is sourced from PubChem (CID 155610131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).