C46H48GeIrN4O-2 — CID 155610912
CID 155610912 (PubChem CID 155610912) has the molecular formula C46H48GeIrN4O-2 and a molecular weight of 941.77 g/mol.
| Compound Name | CID 155610912 |
|---|---|
| PubChem CID | 155610912 |
| Molecular Formula | C46H48GeIrN4O-2 |
| Molecular Weight | 941.77 g/mol |
| Exact Mass | 943.29 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C)C(C)(C)C.[2H]C([2H])(c1ccnc(-c2[c-]ncc3c2oc2nc(-c4ccccc4)ccc23)c1)C1CCCC1.[Ir] |
| InChI | InChI=1S/C27H22N3O.C19H26GeN.Ir/c1-2-8-20(9-3-1)24-11-10-21-22-16-28-17-23(26(22)31-27(21)30-24)25-15-19(12-13-29-25)14-18-6-4-5-7-18;1-19(2,3)13-16-12-18(15-10-8-7-9-11-15)21-14-17(16)20(4,5)6;/h1-3,8-13,15-16,18H,4-7,14H2;7-10,12,14H,13H2,1-6H3;/q2*-1;/i14D2;13D2; |
| InChIKey | HVNGZZXSOOSNNR-RBIQBJQISA-N |
| XLogP | 11.32 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.77 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|